About 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate
3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate (PubChem CID 6442112) has the molecular formula C16H30N2O4
and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate |
| PubChem CID | 6442112 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate |
| SMILES | CC1(C)CC(N)CC(C)(CN)C1.COC(=O)/C=C\C(=O)OC |
| InChI | InChI=1S/C10H22N2.C6H8O4/c1-9(2)4-8(12)5-10(3,6-9)7-11;1-9-5(7)3-4-6(8)10-2/h8H,4-7,11-12H2,1-3H3;3-4H,1-2H3/b;4-3- |
| InChIKey | VLFZTNXHVGLNFH-QGAMPUOQSA-N |
| XLogP | 1.38 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate?
The IUPAC name of 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate (CID 6442112) is 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate.
What is the SMILES notation for 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate?
The canonical SMILES for 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate is CC1(C)CC(N)CC(C)(CN)C1.COC(=O)/C=C\C(=O)OC.
What is the InChIKey of 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate?
The InChIKey is VLFZTNXHVGLNFH-QGAMPUOQSA-N. The full InChI is InChI=1S/C10H22N2.C6H8O4/c1-9(2)4-8(12)5-10(3,6-9)7-11;1-9-5(7)3-4-6(8)10-2/h8H,4-7,11-12H2,1-3H3;3-4H,1-2H3/b;4-3-.
What are the key properties of 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate?
3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate has a molecular weight of 314.43 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;dimethyl (Z)-but-2-enedioate is sourced from PubChem (CID 6442112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).