C19H26O6 — CID 6442150
(2R)-2-[(1E,3R,4R,6R,7Z,9Z,11E)-3,4,6,13-tetrahydroxy-3-methyltrideca-1,7,9,11-tetraenyl]-2,3-dihydropyran-6-one (PubChem CID 6442150) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (2R)-2-[(1E,3R,4R,6R,7Z,9Z,11E)-3,4,6,13-tetrahydroxy-3-methyltrideca-1,7,9,11-tetraenyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3R,4R,6R,7Z,9Z,11E)-3,4,6,13-tetrahydroxy-3-methyltrideca-1,7,9,11-tetraenyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 6442150 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2R)-2-[(1E,3R,4R,6R,7Z,9Z,11E)-3,4,6,13-tetrahydroxy-3-methyltrideca-1,7,9,11-tetraenyl]-2,3-dihydropyran-6-one |
| SMILES | C[C@@](O)(/C=C/[C@H]1CC=CC(=O)O1)[C@H](O)C[C@@H](O)/C=C\C=C/C=C/CO |
| InChI | InChI=1S/C19H26O6/c1-19(24,12-11-16-9-7-10-18(23)25-16)17(22)14-15(21)8-5-3-2-4-6-13-20/h2-8,10-12,15-17,20-22,24H,9,13-14H2,1H3/b3-2-,6-4+,8-5-,12-11+/t15-,16+,17+,19+/m0/s1 |
| InChIKey | KTHVJFIZRQNFEZ-DSWNLJKISA-N |
| XLogP | 0.94 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|