About (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one
(9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one (PubChem CID 6442185) has the molecular formula C17H22O2
and a molecular weight of 258.36 g/mol. Its IUPAC name is (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one.
Molecular Properties
| Compound Name | (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one |
| PubChem CID | 6442185 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one |
| SMILES | C=CC(=O)C#CC#CC(O)/C=C\CCCCCCC |
| InChI | InChI=1S/C17H22O2/c1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h4,10,14,17,19H,2-3,5-9H2,1H3/b14-10- |
| InChIKey | STNWZOBISHHDCD-UVTDQMKNSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one?
The IUPAC name of (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one (CID 6442185) is (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one.
What is the SMILES notation for (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one?
The canonical SMILES for (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one is C=CC(=O)C#CC#CC(O)/C=C\CCCCCCC.
What is the InChIKey of (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one?
The InChIKey is STNWZOBISHHDCD-UVTDQMKNSA-N. The full InChI is InChI=1S/C17H22O2/c1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h4,10,14,17,19H,2-3,5-9H2,1H3/b14-10-.
What are the key properties of (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one?
(9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one has a molecular weight of 258.36 g/mol, XLogP of 3.03, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one is sourced from PubChem (CID 6442185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).