About (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide
(E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide (PubChem CID 6442279) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide.
Molecular Properties
| Compound Name | (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide |
| PubChem CID | 6442279 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide |
| SMILES | C/C(=C\c1ccccc1)CC(=O)N(CCO)CCO |
| InChI | InChI=1S/C15H21NO3/c1-13(11-14-5-3-2-4-6-14)12-15(19)16(7-9-17)8-10-18/h2-6,11,17-18H,7-10,12H2,1H3/b13-11+ |
| InChIKey | MNZGTGCNSJEMPU-ACCUITESSA-N |
| XLogP | 1.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide?
The IUPAC name of (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide (CID 6442279) is (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide.
What is the SMILES notation for (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide?
The canonical SMILES for (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide is C/C(=C\c1ccccc1)CC(=O)N(CCO)CCO.
What is the InChIKey of (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide?
The InChIKey is MNZGTGCNSJEMPU-ACCUITESSA-N. The full InChI is InChI=1S/C15H21NO3/c1-13(11-14-5-3-2-4-6-14)12-15(19)16(7-9-17)8-10-18/h2-6,11,17-18H,7-10,12H2,1H3/b13-11+.
What are the key properties of (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide?
(E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide has a molecular weight of 263.34 g/mol, XLogP of 1.29, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-bis(2-hydroxyethyl)-3-methyl-4-phenylbut-3-enamide is sourced from PubChem (CID 6442279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).