C20H26O5 — CID 6442404
[4-hydroxy-2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 6442404) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is [4-hydroxy-2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [4-hydroxy-2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 6442404 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [4-hydroxy-2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC1=C(C)C(=O)C(O)=C([C@H](C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C20H26O5/c1-7-12(4)20(24)25-19-14(6)16(21)17(22)15(18(19)23)13(5)10-8-9-11(2)3/h7,9,13,22H,8,10H2,1-6H3/b12-7-/t13-/m1/s1 |
| InChIKey | FQYUJVNWZSUXNR-FFXRNRBCSA-N |
| XLogP | 4.12 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|