C15H26O2 — CID 6442580
(1R,2S,3R)-3-[(5E)-7-hydroxy-6-methylhepta-1,5-dien-2-yl]-1,2-dimethylcyclopentan-1-ol (PubChem CID 6442580) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,2S,3R)-3-[(5E)-7-hydroxy-6-methylhepta-1,5-dien-2-yl]-1,2-dimethylcyclopentan-1-ol.
| Compound Name | (1R,2S,3R)-3-[(5E)-7-hydroxy-6-methylhepta-1,5-dien-2-yl]-1,2-dimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 6442580 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,2S,3R)-3-[(5E)-7-hydroxy-6-methylhepta-1,5-dien-2-yl]-1,2-dimethylcyclopentan-1-ol |
| SMILES | C=C(CC/C=C(\C)CO)[C@@H]1CC[C@@](C)(O)[C@H]1C |
| InChI | InChI=1S/C15H26O2/c1-11(10-16)6-5-7-12(2)14-8-9-15(4,17)13(14)3/h6,13-14,16-17H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14-,15+/m0/s1 |
| InChIKey | HGGIETPLSCSCRB-JWHNLWTMSA-N |
| XLogP | 3.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|