About (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol
(E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol (PubChem CID 6442586) has the molecular formula C17H34O2Si
and a molecular weight of 298.54 g/mol. Its IUPAC name is (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol |
| PubChem CID | 6442586 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCC[C@@H]1CC/C=C/CO |
| InChI | InChI=1S/C17H34O2Si/c1-17(2,3)20(4,5)19-16-13-9-8-12-15(16)11-7-6-10-14-18/h6,10,15-16,18H,7-9,11-14H2,1-5H3/b10-6+/t15-,16-/m0/s1 |
| InChIKey | XOSVJDNNOVFMAB-DAASWOGBSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol?
The IUPAC name of (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol (CID 6442586) is (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol.
What is the SMILES notation for (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol?
The canonical SMILES for (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol is CC(C)(C)[Si](C)(C)O[C@H]1CCCC[C@@H]1CC/C=C/CO.
What is the InChIKey of (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol?
The InChIKey is XOSVJDNNOVFMAB-DAASWOGBSA-N. The full InChI is InChI=1S/C17H34O2Si/c1-17(2,3)20(4,5)19-16-13-9-8-12-15(16)11-7-6-10-14-18/h6,10,15-16,18H,7-9,11-14H2,1-5H3/b10-6+/t15-,16-/m0/s1.
What are the key properties of (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol?
(E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol has a molecular weight of 298.54 g/mol, XLogP of 4.90, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxycyclohexyl]pent-2-en-1-ol is sourced from PubChem (CID 6442586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).