About (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine)
(E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine) (PubChem CID 6442705) has the molecular formula C34H46Cl2N4O6
and a molecular weight of 677.67 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine).
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine) |
| PubChem CID | 6442705 |
| Molecular Formula | C34H46Cl2N4O6 |
| Molecular Weight | 677.67 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine) |
| SMILES | CCCOc1ccc2[nH]cc(CCN(C)C)c2c1Cl.CCCOc1ccc2[nH]cc(CCN(C)C)c2c1Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C15H21ClN2O.C4H4O4/c2*1-4-9-19-13-6-5-12-14(15(13)16)11(10-17-12)7-8-18(2)3;5-3(6)1-2-4(7)8/h2*5-6,10,17H,4,7-9H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | DMVXZPOKLOHYDW-WXXKFALUSA-N |
| XLogP | 7.14 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 677.67 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine)?
The IUPAC name of (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine) (CID 6442705) is (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine).
What is the SMILES notation for (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine)?
The canonical SMILES for (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine) is CCCOc1ccc2[nH]cc(CCN(C)C)c2c1Cl.CCCOc1ccc2[nH]cc(CCN(C)C)c2c1Cl.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine)?
The InChIKey is DMVXZPOKLOHYDW-WXXKFALUSA-N. The full InChI is InChI=1S/2C15H21ClN2O.C4H4O4/c2*1-4-9-19-13-6-5-12-14(15(13)16)11(10-17-12)7-8-18(2)3;5-3(6)1-2-4(7)8/h2*5-6,10,17H,4,7-9H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+.
What are the key properties of (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine)?
(E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine) has a molecular weight of 677.67 g/mol, XLogP of 7.14, 14 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;bis(2-(4-chloro-5-propoxy-1H-indol-3-yl)-N,N-dimethylethanamine) is sourced from PubChem (CID 6442705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).