About tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane
tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane (PubChem CID 6442712) has the molecular formula C25H46OSi
and a molecular weight of 390.73 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane |
| PubChem CID | 6442712 |
| Molecular Formula | C25H46OSi |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 390.33 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane |
| SMILES | CCCCCCC#CC/C=C(\C)C[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46OSi/c1-8-9-10-11-12-13-14-15-18-22(2)21-23-19-16-17-20-24(23)26-27(6,7)25(3,4)5/h18,23-24H,8-12,15-17,19-21H2,1-7H3/b22-18+/t23-,24+/m1/s1 |
| InChIKey | NGBAIWZTAAILKV-GOWHRGTCSA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane?
The IUPAC name of tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane (CID 6442712) is tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane.
What is the SMILES notation for tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane?
The canonical SMILES for tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane is CCCCCCC#CC/C=C(\C)C[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane?
The InChIKey is NGBAIWZTAAILKV-GOWHRGTCSA-N. The full InChI is InChI=1S/C25H46OSi/c1-8-9-10-11-12-13-14-15-18-22(2)21-23-19-16-17-20-24(23)26-27(6,7)25(3,4)5/h18,23-24H,8-12,15-17,19-21H2,1-7H3/b22-18+/t23-,24+/m1/s1.
What are the key properties of tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane?
tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane has a molecular weight of 390.73 g/mol, XLogP of 8.27, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methyldodec-2-en-5-ynyl]cyclohexyl]oxysilane is sourced from PubChem (CID 6442712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).