C25H48OSi — CID 6442713
tert-butyl-dimethyl-[(1S,2R)-2-[(2E,5E)-2-methyldodeca-2,5-dienyl]cyclohexyl]oxysilane (PubChem CID 6442713) has the molecular formula C25H48OSi and a molecular weight of 392.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,2R)-2-[(2E,5E)-2-methyldodeca-2,5-dienyl]cyclohexyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S,2R)-2-[(2E,5E)-2-methyldodeca-2,5-dienyl]cyclohexyl]oxysilane |
|---|---|
| PubChem CID | 6442713 |
| Molecular Formula | C25H48OSi |
| Molecular Weight | 392.74 g/mol |
| Exact Mass | 392.35 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,2R)-2-[(2E,5E)-2-methyldodeca-2,5-dienyl]cyclohexyl]oxysilane |
| SMILES | CCCCCC/C=C/C/C=C(\C)C[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48OSi/c1-8-9-10-11-12-13-14-15-18-22(2)21-23-19-16-17-20-24(23)26-27(6,7)25(3,4)5/h13-14,18,23-24H,8-12,15-17,19-21H2,1-7H3/b14-13+,22-18+/t23-,24+/m1/s1 |
| InChIKey | HXYIMKHLBCHRSV-PXPIWGARSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.74 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|