About tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane
tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane (PubChem CID 6442717) has the molecular formula C16H31IOSi
and a molecular weight of 394.41 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane |
| PubChem CID | 6442717 |
| Molecular Formula | C16H31IOSi |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane |
| SMILES | C/C(=C\I)C[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31IOSi/c1-13(12-17)11-14-9-7-8-10-15(14)18-19(5,6)16(2,3)4/h12,14-15H,7-11H2,1-6H3/b13-12+/t14-,15+/m1/s1 |
| InChIKey | FTIDVYDFWVKVEV-WCVFXIOZSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane (CID 6442717) is tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane is C/C(=C\I)C[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane?
The InChIKey is FTIDVYDFWVKVEV-WCVFXIOZSA-N. The full InChI is InChI=1S/C16H31IOSi/c1-13(12-17)11-14-9-7-8-10-15(14)18-19(5,6)16(2,3)4/h12,14-15H,7-11H2,1-6H3/b13-12+/t14-,15+/m1/s1.
What are the key properties of tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane?
tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane has a molecular weight of 394.41 g/mol, XLogP of 6.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S,2R)-2-[(E)-3-iodo-2-methylprop-2-enyl]cyclohexyl]oxy-dimethylsilane is sourced from PubChem (CID 6442717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).