About tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane
tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane (PubChem CID 6442720) has the molecular formula C17H34OSi
and a molecular weight of 282.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane |
| PubChem CID | 6442720 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane |
| SMILES | C/C=C(\C)C[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34OSi/c1-8-14(2)13-15-11-9-10-12-16(15)18-19(6,7)17(3,4)5/h8,15-16H,9-13H2,1-7H3/b14-8+/t15-,16+/m1/s1 |
| InChIKey | ISVVKQLEAYNEMA-HVJILKDESA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane?
The IUPAC name of tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane (CID 6442720) is tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane.
What is the SMILES notation for tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane?
The canonical SMILES for tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane is C/C=C(\C)C[C@H]1CCCC[C@@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane?
The InChIKey is ISVVKQLEAYNEMA-HVJILKDESA-N. The full InChI is InChI=1S/C17H34OSi/c1-8-14(2)13-15-11-9-10-12-16(15)18-19(6,7)17(3,4)5/h8,15-16H,9-13H2,1-7H3/b14-8+/t15-,16+/m1/s1.
What are the key properties of tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane?
tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane has a molecular weight of 282.54 g/mol, XLogP of 5.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(1S,2R)-2-[(E)-2-methylbut-2-enyl]cyclohexyl]oxysilane is sourced from PubChem (CID 6442720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).