C21H35NO — CID 6442886
1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]azepan-2-one (PubChem CID 6442886) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]azepan-2-one.
| Compound Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]azepan-2-one |
|---|---|
| PubChem CID | 6442886 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]azepan-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCCCCC1=O |
| InChI | InChI=1S/C21H35NO/c1-18(2)10-8-11-19(3)12-9-13-20(4)15-17-22-16-7-5-6-14-21(22)23/h10,12,15H,5-9,11,13-14,16-17H2,1-4H3/b19-12+,20-15+ |
| InChIKey | IGLWKWHEKADLNX-IRVPIMSSSA-N |
| XLogP | 5.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|