C8H10ClF3 — CID 6442893
(2Z)-2-chloro-1,1,1-trifluoro-6-methylhepta-2,5-diene (PubChem CID 6442893) has the molecular formula C8H10ClF3 and a molecular weight of 198.62 g/mol. Its IUPAC name is (2Z)-2-chloro-1,1,1-trifluoro-6-methylhepta-2,5-diene.
| Compound Name | (2Z)-2-chloro-1,1,1-trifluoro-6-methylhepta-2,5-diene |
|---|---|
| PubChem CID | 6442893 |
| Molecular Formula | C8H10ClF3 |
| Molecular Weight | 198.62 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (2Z)-2-chloro-1,1,1-trifluoro-6-methylhepta-2,5-diene |
| SMILES | CC(C)=CC/C=C(\Cl)C(F)(F)F |
| InChI | InChI=1S/C8H10ClF3/c1-6(2)4-3-5-7(9)8(10,11)12/h4-5H,3H2,1-2H3/b7-5- |
| InChIKey | PCKFNFDGDUEJNZ-ALCCZGGFSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|