C30H44O10 — CID 6442972
[(1S,2S,3R,4R,7S,8Z,12S,13S,14R,15R)-14,15-diacetyloxy-2,3-dihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] hexanoate (PubChem CID 6442972) has the molecular formula C30H44O10 and a molecular weight of 564.67 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7S,8Z,12S,13S,14R,15R)-14,15-diacetyloxy-2,3-dihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] hexanoate.
| Compound Name | [(1S,2S,3R,4R,7S,8Z,12S,13S,14R,15R)-14,15-diacetyloxy-2,3-dihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] hexanoate |
|---|---|
| PubChem CID | 6442972 |
| Molecular Formula | C30H44O10 |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | [(1S,2S,3R,4R,7S,8Z,12S,13S,14R,15R)-14,15-diacetyloxy-2,3-dihydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-12-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1CC/C(C)=C\[C@@H]2OC(=O)[C@H](C)[C@@]2(O)[C@@H](O)[C@H]2C(C)=C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C30H44O10/c1-8-9-10-11-24(33)39-22-13-12-16(2)14-23-30(36,18(4)28(35)40-23)26(34)25-17(3)15-21(37-19(5)31)27(29(22,25)7)38-20(6)32/h14-15,18,21-23,25-27,34,36H,8-13H2,1-7H3/b16-14-/t18-,21+,22-,23-,25+,26-,27-,29+,30-/m0/s1 |
| InChIKey | RHQDEEDZJCZIOP-ZIWVANHVSA-N |
| XLogP | 3.32 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|