About (E)-4-oxodec-2-enal
(E)-4-oxodec-2-enal (PubChem CID 6442990) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (E)-4-oxodec-2-enal.
Molecular Properties
| Compound Name | (E)-4-oxodec-2-enal |
| PubChem CID | 6442990 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (E)-4-oxodec-2-enal |
| SMILES | CCCCCCC(=O)/C=C/C=O |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-5-7-10(12)8-6-9-11/h6,8-9H,2-5,7H2,1H3/b8-6+ |
| InChIKey | TYFWJIXSKYGHKW-SOFGYWHQSA-N |
| XLogP | 2.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-oxodec-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-oxodec-2-enal?
The IUPAC name of (E)-4-oxodec-2-enal (CID 6442990) is (E)-4-oxodec-2-enal.
What is the SMILES notation for (E)-4-oxodec-2-enal?
The canonical SMILES for (E)-4-oxodec-2-enal is CCCCCCC(=O)/C=C/C=O.
What is the InChIKey of (E)-4-oxodec-2-enal?
The InChIKey is TYFWJIXSKYGHKW-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H16O2/c1-2-3-4-5-7-10(12)8-6-9-11/h6,8-9H,2-5,7H2,1H3/b8-6+.
What are the key properties of (E)-4-oxodec-2-enal?
(E)-4-oxodec-2-enal has a molecular weight of 168.24 g/mol, XLogP of 2.28, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-oxodec-2-enal is sourced from PubChem (CID 6442990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).