C23H40O4 — CID 6443027
[(2R,12Z,15Z)-2-hydroxy-4-oxohenicosa-12,15-dienyl] acetate (PubChem CID 6443027) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is [(2R,12Z,15Z)-2-hydroxy-4-oxohenicosa-12,15-dienyl] acetate.
| Compound Name | [(2R,12Z,15Z)-2-hydroxy-4-oxohenicosa-12,15-dienyl] acetate |
|---|---|
| PubChem CID | 6443027 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | [(2R,12Z,15Z)-2-hydroxy-4-oxohenicosa-12,15-dienyl] acetate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C[C@@H](O)COC(C)=O |
| InChI | InChI=1S/C23H40O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(25)19-23(26)20-27-21(2)24/h7-8,10-11,23,26H,3-6,9,12-20H2,1-2H3/b8-7-,11-10-/t23-/m1/s1 |
| InChIKey | IBDVBNUJEGRVQN-RHNLGMIQSA-N |
| XLogP | 5.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|