About 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one
4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one (PubChem CID 6443035) has the molecular formula C14H18O5
and a molecular weight of 266.29 g/mol. Its IUPAC name is 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one.
Molecular Properties
| Compound Name | 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one |
| PubChem CID | 6443035 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one |
| SMILES | COC1=C(C(C)=O)C(=O)C(C)(/C=C/C=C/C(C)O)O1 |
| InChI | InChI=1S/C14H18O5/c1-9(15)7-5-6-8-14(3)12(17)11(10(2)16)13(18-4)19-14/h5-9,15H,1-4H3/b7-5+,8-6+ |
| InChIKey | VDFINAVPDXADRJ-KQQUZDAGSA-N |
| XLogP | 1.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one?
The IUPAC name of 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one (CID 6443035) is 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one.
What is the SMILES notation for 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one?
The canonical SMILES for 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one is COC1=C(C(C)=O)C(=O)C(C)(/C=C/C=C/C(C)O)O1.
What is the InChIKey of 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one?
The InChIKey is VDFINAVPDXADRJ-KQQUZDAGSA-N. The full InChI is InChI=1S/C14H18O5/c1-9(15)7-5-6-8-14(3)12(17)11(10(2)16)13(18-4)19-14/h5-9,15H,1-4H3/b7-5+,8-6+.
What are the key properties of 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one?
4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one has a molecular weight of 266.29 g/mol, XLogP of 1.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-2-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one is sourced from PubChem (CID 6443035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).