C14H18O3 — CID 6443189
(2E,6E,9Z)-3,7-dimethyl-8,11-dioxododeca-2,6,9-trienal (PubChem CID 6443189) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (2E,6E,9Z)-3,7-dimethyl-8,11-dioxododeca-2,6,9-trienal.
| Compound Name | (2E,6E,9Z)-3,7-dimethyl-8,11-dioxododeca-2,6,9-trienal |
|---|---|
| PubChem CID | 6443189 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2E,6E,9Z)-3,7-dimethyl-8,11-dioxododeca-2,6,9-trienal |
| SMILES | CC(=O)/C=C\C(=O)/C(C)=C/CC/C(C)=C/C=O |
| InChI | InChI=1S/C14H18O3/c1-11(9-10-15)5-4-6-12(2)14(17)8-7-13(3)16/h6-10H,4-5H2,1-3H3/b8-7-,11-9+,12-6+ |
| InChIKey | PQXIJIXNDRFJBT-CRLUEARGSA-N |
| XLogP | 2.57 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|