C14H21NO2 — CID 6443498
1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidine-2,5-dione (PubChem CID 6443498) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6443498 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)=CCC/C(C)=C/CN1C(=O)CCC1=O |
| InChI | InChI=1S/C14H21NO2/c1-11(2)5-4-6-12(3)9-10-15-13(16)7-8-14(15)17/h5,9H,4,6-8,10H2,1-3H3/b12-9+ |
| InChIKey | DOHHWSJQPNKWBM-FMIVXFBMSA-N |
| XLogP | 2.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|