About [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate
[2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate (PubChem CID 644355) has the molecular formula C21H19N3O3
and a molecular weight of 361.40 g/mol. Its IUPAC name is [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate.
Molecular Properties
| Compound Name | [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate |
| PubChem CID | 644355 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate |
| SMILES | CN(C)CC(=O)Oc1ccc2[nH]c(C(=O)c3cc4ccccc4[nH]3)cc2c1 |
| InChI | InChI=1S/C21H19N3O3/c1-24(2)12-20(25)27-15-7-8-17-14(9-15)11-19(23-17)21(26)18-10-13-5-3-4-6-16(13)22-18/h3-11,22-23H,12H2,1-2H3 |
| InChIKey | HFEANGBCVOPJFK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate?
The IUPAC name of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate (CID 644355) is [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate.
What is the SMILES notation for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate?
The canonical SMILES for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate is CN(C)CC(=O)Oc1ccc2[nH]c(C(=O)c3cc4ccccc4[nH]3)cc2c1.
What is the InChIKey of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate?
The InChIKey is HFEANGBCVOPJFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O3/c1-24(2)12-20(25)27-15-7-8-17-14(9-15)11-19(23-17)21(26)18-10-13-5-3-4-6-16(13)22-18/h3-11,22-23H,12H2,1-2H3.
What are the key properties of [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate?
[2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate has a molecular weight of 361.40 g/mol, XLogP of 3.35, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] 2-(dimethylamino)acetate is sourced from PubChem (CID 644355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).