C15H20O2 — CID 6443584
(3Z,7Z,9R)-4,8,12-trimethyl-10-oxabicyclo[7.3.1]trideca-1(12),3,7-trien-11-one (PubChem CID 6443584) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3Z,7Z,9R)-4,8,12-trimethyl-10-oxabicyclo[7.3.1]trideca-1(12),3,7-trien-11-one.
| Compound Name | (3Z,7Z,9R)-4,8,12-trimethyl-10-oxabicyclo[7.3.1]trideca-1(12),3,7-trien-11-one |
|---|---|
| PubChem CID | 6443584 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3Z,7Z,9R)-4,8,12-trimethyl-10-oxabicyclo[7.3.1]trideca-1(12),3,7-trien-11-one |
| SMILES | CC1=C2C/C=C(/C)CC/C=C(/C)[C@@H](C2)OC1=O |
| InChI | InChI=1S/C15H20O2/c1-10-5-4-6-11(2)14-9-13(8-7-10)12(3)15(16)17-14/h6-7,14H,4-5,8-9H2,1-3H3/b10-7-,11-6-/t14-/m1/s1 |
| InChIKey | WQSQTKXRQDVOIO-DXNXGREHSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|