C21H36O5 — CID 6443593
methyl 7-[(1R,3S,5R)-3-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxocyclopentyl]heptanoate (PubChem CID 6443593) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is methyl 7-[(1R,3S,5R)-3-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,3S,5R)-3-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 6443593 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | methyl 7-[(1R,3S,5R)-3-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxocyclopentyl]heptanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C[C@H](O)C(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C21H36O5/c1-3-4-7-10-17(22)14-13-16-15-19(23)21(25)18(16)11-8-5-6-9-12-20(24)26-2/h13-14,16-19,22-23H,3-12,15H2,1-2H3/b14-13+/t16-,17-,18+,19-/m0/s1 |
| InChIKey | KJMHVOVUFMQGEJ-NRVWHEPXSA-N |
| XLogP | 3.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|