About [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate
[3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate (PubChem CID 6443603) has the molecular formula C41H54O5
and a molecular weight of 626.88 g/mol. Its IUPAC name is [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate |
| PubChem CID | 6443603 |
| Molecular Formula | C41H54O5 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.40 |
| IUPAC Name | [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CO)OC(=O)CCCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C41H54O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-38(43)45-31-36(30-42)46-39(44)23-18-19-32-24-25-35-27-26-33-20-17-21-34-28-29-37(32)41(35)40(33)34/h9-10,17,20-21,24-29,36,42H,2-8,11-16,18-19,22-23,30-31H2,1H3/b10-9- |
| InChIKey | IHCGSLDGWMPWJG-KTKRTIGZSA-N |
| XLogP | 10.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate?
The IUPAC name of [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate (CID 6443603) is [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate.
What is the SMILES notation for [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate?
The canonical SMILES for [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CO)OC(=O)CCCc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate?
The InChIKey is IHCGSLDGWMPWJG-KTKRTIGZSA-N. The full InChI is InChI=1S/C41H54O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-38(43)45-31-36(30-42)46-39(44)23-18-19-32-24-25-35-27-26-33-20-17-21-34-28-29-37(32)41(35)40(33)34/h9-10,17,20-21,24-29,36,42H,2-8,11-16,18-19,22-23,30-31H2,1H3/b10-9-.
What are the key properties of [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate?
[3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate has a molecular weight of 626.88 g/mol, XLogP of 10.39, 23 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-2-(4-pyren-1-ylbutanoyloxy)propyl] (Z)-octadec-9-enoate is sourced from PubChem (CID 6443603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).