C19H30O4 — CID 6443611
2-cyclohexyl-2-[(2E)-3,7-dimethylocta-2,6-dienyl]propanedioic acid (PubChem CID 6443611) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-cyclohexyl-2-[(2E)-3,7-dimethylocta-2,6-dienyl]propanedioic acid.
| Compound Name | 2-cyclohexyl-2-[(2E)-3,7-dimethylocta-2,6-dienyl]propanedioic acid |
|---|---|
| PubChem CID | 6443611 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-cyclohexyl-2-[(2E)-3,7-dimethylocta-2,6-dienyl]propanedioic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC(C(=O)O)(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C19H30O4/c1-14(2)8-7-9-15(3)12-13-19(17(20)21,18(22)23)16-10-5-4-6-11-16/h8,12,16H,4-7,9-11,13H2,1-3H3,(H,20,21)(H,22,23)/b15-12+ |
| InChIKey | RWZTZYGOHTYHLY-NTCAYCPXSA-N |
| XLogP | 4.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|