C20H30F2O2 — CID 6444130
(5E,8E,11E,14E)-10,10-difluoroicosa-5,8,11,14-tetraenoic acid (PubChem CID 6444130) has the molecular formula C20H30F2O2 and a molecular weight of 340.45 g/mol. Its IUPAC name is (5E,8E,11E,14E)-10,10-difluoroicosa-5,8,11,14-tetraenoic acid.
| Compound Name | (5E,8E,11E,14E)-10,10-difluoroicosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 6444130 |
| Molecular Formula | C20H30F2O2 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (5E,8E,11E,14E)-10,10-difluoroicosa-5,8,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C/C/C=C/C(F)(F)/C=C/C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C20H30F2O2/c1-2-3-4-5-6-8-11-14-17-20(21,22)18-15-12-9-7-10-13-16-19(23)24/h6-9,14-15,17-18H,2-5,10-13,16H2,1H3,(H,23,24)/b8-6+,9-7+,17-14+,18-15+ |
| InChIKey | GCPGXCVCWYWJAX-BQGGUJHBSA-N |
| XLogP | 6.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|