C23H39NO5 — CID 6444189
(2S)-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanedioic acid (PubChem CID 6444189) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is (2S)-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 6444189 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | (2S)-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]pentanedioic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H39NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)24-20(23(28)29)18-19-22(26)27/h6-7,9-10,20H,2-5,8,11-19H2,1H3,(H,24,25)(H,26,27)(H,28,29)/b7-6-,10-9-/t20-/m0/s1 |
| InChIKey | KUOWDMBZTRBDRI-GSNKCQISSA-N |
| XLogP | 5.23 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|