About (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine
(E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine (PubChem CID 6444340) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine.
Analyze (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine?
The IUPAC name of (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine (CID 6444340) is (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine.
What is the SMILES notation for (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine?
The canonical SMILES for (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine is CN(C)/C=C/CN(C)C.
What is the InChIKey of (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine?
The InChIKey is LWVVNNZRDBXOQL-AATRIKPKSA-N. The full InChI is InChI=1S/C7H16N2/c1-8(2)6-5-7-9(3)4/h5-6H,7H2,1-4H3/b6-5+.
What are the key properties of (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine?
(E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine has a molecular weight of 128.22 g/mol, XLogP of 0.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N,N',N'-tetramethylprop-1-ene-1,3-diamine is sourced from PubChem (CID 6444340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).