C29H31NO4 — CID 6444457
(Z)-but-2-enedioic acid;N,2-dimethyl-3,3-diphenyl-N-(2-phenylethyl)prop-2-en-1-amine (PubChem CID 6444457) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N,2-dimethyl-3,3-diphenyl-N-(2-phenylethyl)prop-2-en-1-amine.
| Compound Name | (Z)-but-2-enedioic acid;N,2-dimethyl-3,3-diphenyl-N-(2-phenylethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 6444457 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;N,2-dimethyl-3,3-diphenyl-N-(2-phenylethyl)prop-2-en-1-amine |
| SMILES | CC(CN(C)CCc1ccccc1)=C(c1ccccc1)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H27N.C4H4O4/c1-21(20-26(2)19-18-22-12-6-3-7-13-22)25(23-14-8-4-9-15-23)24-16-10-5-11-17-24;5-3(6)1-2-4(7)8/h3-17H,18-20H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | NBDDDYSYONWVMC-BTJKTKAUSA-N |
| XLogP | 5.39 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|