C24H28N2O4S — CID 6444463
(E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-ethylpiperazine (PubChem CID 6444463) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-ethylpiperazine.
| Compound Name | (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-ethylpiperazine |
|---|---|
| PubChem CID | 6444463 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-4-ethylpiperazine |
| SMILES | CCN1CCN(C2Cc3ccccc3Sc3ccccc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H24N2S.C4H4O4/c1-2-21-11-13-22(14-12-21)18-15-16-7-3-5-9-19(16)23-20-10-6-4-8-17(18)20;5-3(6)1-2-4(7)8/h3-10,18H,2,11-15H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | NVSSBIXBPOFLAW-WLHGVMLRSA-N |
| XLogP | 3.78 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|