About (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one
(4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 6444485) has the molecular formula C31H22N4O2
and a molecular weight of 482.54 g/mol. Its IUPAC name is (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one.
Molecular Properties
| Compound Name | (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one |
| PubChem CID | 6444485 |
| Molecular Formula | C31H22N4O2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | O=C1/C(=C\C2C(=O)N(c3ccccc3)N=C2c2ccccc2)C(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C31H22N4O2/c36-30-26(28(22-13-5-1-6-14-22)32-34(30)24-17-9-3-10-18-24)21-27-29(23-15-7-2-8-16-23)33-35(31(27)37)25-19-11-4-12-20-25/h1-21,26H/b27-21- |
| InChIKey | FAOSAWSOYDVFQW-MEFGMAGPSA-N |
| XLogP | 5.43 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one?
The IUPAC name of (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one (CID 6444485) is (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one.
What is the SMILES notation for (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one?
The canonical SMILES for (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one is O=C1/C(=C\C2C(=O)N(c3ccccc3)N=C2c2ccccc2)C(c2ccccc2)=NN1c1ccccc1.
What is the InChIKey of (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one?
The InChIKey is FAOSAWSOYDVFQW-MEFGMAGPSA-N. The full InChI is InChI=1S/C31H22N4O2/c36-30-26(28(22-13-5-1-6-14-22)32-34(30)24-17-9-3-10-18-24)21-27-29(23-15-7-2-8-16-23)33-35(31(27)37)25-19-11-4-12-20-25/h1-21,26H/b27-21-.
What are the key properties of (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one?
(4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one has a molecular weight of 482.54 g/mol, XLogP of 5.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one is sourced from PubChem (CID 6444485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).