About (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide
(E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 6444575) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| PubChem CID | 6444575 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | C=CCNC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H19NO4/c1-5-8-16-14(17)7-6-11-9-12(18-2)15(20-4)13(10-11)19-3/h5-7,9-10H,1,8H2,2-4H3,(H,16,17)/b7-6+ |
| InChIKey | LEWMQCAPBAEVIL-VOTSOKGWSA-N |
| XLogP | 2.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide?
The IUPAC name of (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (CID 6444575) is (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
What is the SMILES notation for (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide?
The canonical SMILES for (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide is C=CCNC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide?
The InChIKey is LEWMQCAPBAEVIL-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H19NO4/c1-5-8-16-14(17)7-6-11-9-12(18-2)15(20-4)13(10-11)19-3/h5-7,9-10H,1,8H2,2-4H3,(H,16,17)/b7-6+.
What are the key properties of (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide?
(E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide has a molecular weight of 277.32 g/mol, XLogP of 2.03, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)prop-2-enamide is sourced from PubChem (CID 6444575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).