About 3,6-dimethoxy-9H-carbazole
3,6-dimethoxy-9H-carbazole (PubChem CID 644464) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is 3,6-dimethoxy-9H-carbazole.
Molecular Properties
| Compound Name | 3,6-dimethoxy-9H-carbazole |
| PubChem CID | 644464 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3,6-dimethoxy-9H-carbazole |
| SMILES | COc1ccc2[nH]c3ccc(OC)cc3c2c1 |
| InChI | InChI=1S/C14H13NO2/c1-16-9-3-5-13-11(7-9)12-8-10(17-2)4-6-14(12)15-13/h3-8,15H,1-2H3 |
| InChIKey | YQKMWXHJSIEAEX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethoxy-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethoxy-9H-carbazole?
The IUPAC name of 3,6-dimethoxy-9H-carbazole (CID 644464) is 3,6-dimethoxy-9H-carbazole.
What is the SMILES notation for 3,6-dimethoxy-9H-carbazole?
The canonical SMILES for 3,6-dimethoxy-9H-carbazole is COc1ccc2[nH]c3ccc(OC)cc3c2c1.
What is the InChIKey of 3,6-dimethoxy-9H-carbazole?
The InChIKey is YQKMWXHJSIEAEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c1-16-9-3-5-13-11(7-9)12-8-10(17-2)4-6-14(12)15-13/h3-8,15H,1-2H3.
What are the key properties of 3,6-dimethoxy-9H-carbazole?
3,6-dimethoxy-9H-carbazole has a molecular weight of 227.26 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethoxy-9H-carbazole is sourced from PubChem (CID 644464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).