C21H24N2O4S2 — CID 6444663
(E)-but-2-enedioic acid;1-(5,10-dihydrothieno[2,3-c][2]benzothiepin-10-yl)-4-methylpiperazine (PubChem CID 6444663) has the molecular formula C21H24N2O4S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(5,10-dihydrothieno[2,3-c][2]benzothiepin-10-yl)-4-methylpiperazine.
| Compound Name | (E)-but-2-enedioic acid;1-(5,10-dihydrothieno[2,3-c][2]benzothiepin-10-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 6444663 |
| Molecular Formula | C21H24N2O4S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(5,10-dihydrothieno[2,3-c][2]benzothiepin-10-yl)-4-methylpiperazine |
| SMILES | CN1CCN(C2c3ccccc3CSc3sccc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H20N2S2.C4H4O4/c1-18-7-9-19(10-8-18)16-14-5-3-2-4-13(14)12-21-17-15(16)6-11-20-17;5-3(6)1-2-4(7)8/h2-6,11,16H,7-10,12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FVSFAUSEOIQWQA-WLHGVMLRSA-N |
| XLogP | 3.40 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|