About 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid
1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid (PubChem CID 6444758) has the molecular formula C29H30N2O4S
and a molecular weight of 502.64 g/mol. Its IUPAC name is 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid.
Molecular Properties
| Compound Name | 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid |
| PubChem CID | 6444758 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc(CN2CCN(C3Cc4ccccc4Sc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C25H26N2S.C4H4O4/c1-2-8-20(9-3-1)19-26-14-16-27(17-15-26)23-18-21-10-4-6-12-24(21)28-25-13-7-5-11-22(23)25;5-3(6)1-2-4(7)8/h1-13,23H,14-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | TZDHWCHUVJCGPO-WLHGVMLRSA-N |
| XLogP | 4.96 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid?
The IUPAC name of 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid (CID 6444758) is 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid.
What is the SMILES notation for 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid?
The canonical SMILES for 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid is O=C(O)/C=C/C(=O)O.c1ccc(CN2CCN(C3Cc4ccccc4Sc4ccccc43)CC2)cc1.
What is the InChIKey of 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid?
The InChIKey is TZDHWCHUVJCGPO-WLHGVMLRSA-N. The full InChI is InChI=1S/C25H26N2S.C4H4O4/c1-2-8-20(9-3-1)19-26-14-16-27(17-15-26)23-18-21-10-4-6-12-24(21)28-25-13-7-5-11-22(23)25;5-3(6)1-2-4(7)8/h1-13,23H,14-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid?
1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid has a molecular weight of 502.64 g/mol, XLogP of 4.96, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine;(E)-but-2-enedioic acid is sourced from PubChem (CID 6444758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).