About (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine
(Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine (PubChem CID 6444805) has the molecular formula C22H25NO4
and a molecular weight of 367.45 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine |
| PubChem CID | 6444805 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine |
| SMILES | CC(C)N1Cc2ccccc2Cc2ccccc2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H21N.C4H4O4/c1-14(2)19-12-17-9-5-3-7-15(17)11-16-8-4-6-10-18(16)13-19;5-3(6)1-2-4(7)8/h3-10,14H,11-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FJDMWZVOUUYYAE-BTJKTKAUSA-N |
| XLogP | 3.71 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine?
The IUPAC name of (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine (CID 6444805) is (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine.
What is the SMILES notation for (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine?
The canonical SMILES for (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine is CC(C)N1Cc2ccccc2Cc2ccccc2C1.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine?
The InChIKey is FJDMWZVOUUYYAE-BTJKTKAUSA-N. The full InChI is InChI=1S/C18H21N.C4H4O4/c1-14(2)19-12-17-9-5-3-7-15(17)11-16-8-4-6-10-18(16)13-19;5-3(6)1-2-4(7)8/h3-10,14H,11-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine?
(Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine has a molecular weight of 367.45 g/mol, XLogP of 3.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;11-propan-2-yl-10,12-dihydro-5H-benzo[d][2]benzazocine is sourced from PubChem (CID 6444805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).