C33H40N4O9 — CID 6444818
bis((E)-but-2-enedioic acid);2-[2-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]guanidine (PubChem CID 6444818) has the molecular formula C33H40N4O9 and a molecular weight of 636.70 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);2-[2-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]guanidine.
| Compound Name | bis((E)-but-2-enedioic acid);2-[2-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 6444818 |
| Molecular Formula | C33H40N4O9 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | bis((E)-but-2-enedioic acid);2-[2-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]guanidine |
| SMILES | NC(N)=NCCN1C2CCC(OC3c4ccccc4CCc4ccccc43)C1CC2.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H32N4O.2C4H4O4/c26-25(27)28-15-16-29-19-11-13-22(29)23(14-12-19)30-24-20-7-3-1-5-17(20)9-10-18-6-2-4-8-21(18)24;2*5-3(6)1-2-4(7)8/h1-8,19,22-24H,9-16H2,(H4,26,27,28);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | LGKSSSBVLXKANS-LVEZLNDCSA-N |
| XLogP | 2.58 |
| TPSA | 226.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|