C26H28N2O — CID 6444902
(1S,15R,17Z,20R)-17-benzylidene-3,11,12,14,15,16,18,19,20,21-decahydro-1H-yohimban-18-ol (PubChem CID 6444902) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is (1S,15R,17Z,20R)-17-benzylidene-3,11,12,14,15,16,18,19,20,21-decahydro-1H-yohimban-18-ol.
| Compound Name | (1S,15R,17Z,20R)-17-benzylidene-3,11,12,14,15,16,18,19,20,21-decahydro-1H-yohimban-18-ol |
|---|---|
| PubChem CID | 6444902 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (1S,15R,17Z,20R)-17-benzylidene-3,11,12,14,15,16,18,19,20,21-decahydro-1H-yohimban-18-ol |
| SMILES | OC1C[C@H]2C[C@H]3c4[nH]c5ccccc5c4CCN3C[C@@H]2C/C1=C/c1ccccc1 |
| InChI | InChI=1S/C26H28N2O/c29-25-15-18-14-24-26-22(21-8-4-5-9-23(21)27-26)10-11-28(24)16-20(18)13-19(25)12-17-6-2-1-3-7-17/h1-9,12,18,20,24-25,27,29H,10-11,13-16H2/b19-12-/t18-,20+,24+,25?/m1/s1 |
| InChIKey | BRAKELMHNDSLJA-ZEMSXUJDSA-N |
| XLogP | 4.94 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|