C22H35N3O4 — CID 6445012
N',N'-diethyl-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N-dipropylpentanediamide (PubChem CID 6445012) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is N',N'-diethyl-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N-dipropylpentanediamide.
| Compound Name | N',N'-diethyl-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N-dipropylpentanediamide |
|---|---|
| PubChem CID | 6445012 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | N',N'-diethyl-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)C(CCC(=O)N(CC)CC)NC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C22H35N3O4/c1-5-15-25(16-6-2)22(28)19(12-14-21(27)24(7-3)8-4)23-20(26)13-11-18-10-9-17-29-18/h9-11,13,17,19H,5-8,12,14-16H2,1-4H3,(H,23,26)/b13-11+ |
| InChIKey | TYZNAYCPGCUADZ-ACCUITESSA-N |
| XLogP | 3.07 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|