C20H31N3O4 — CID 6445013
2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N-dimethyl-N',N'-dipropylpentanediamide (PubChem CID 6445013) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N-dimethyl-N',N'-dipropylpentanediamide.
| Compound Name | 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N-dimethyl-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 6445013 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N-dimethyl-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCC(NC(=O)/C=C/c1ccco1)C(=O)N(C)C |
| InChI | InChI=1S/C20H31N3O4/c1-5-13-23(14-6-2)19(25)12-10-17(20(26)22(3)4)21-18(24)11-9-16-8-7-15-27-16/h7-9,11,15,17H,5-6,10,12-14H2,1-4H3,(H,21,24)/b11-9+ |
| InChIKey | RMFJQRMLZJRLGN-PKNBQFBNSA-N |
| XLogP | 2.29 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|