C24H39N3O4 — CID 6445014
2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N,N',N'-tetrapropylpentanediamide (PubChem CID 6445014) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N,N',N'-tetrapropylpentanediamide.
| Compound Name | 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N,N',N'-tetrapropylpentanediamide |
|---|---|
| PubChem CID | 6445014 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N,N',N'-tetrapropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCC(NC(=O)/C=C/c1ccco1)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C24H39N3O4/c1-5-15-26(16-6-2)23(29)14-12-21(24(30)27(17-7-3)18-8-4)25-22(28)13-11-20-10-9-19-31-20/h9-11,13,19,21H,5-8,12,14-18H2,1-4H3,(H,25,28)/b13-11+ |
| InChIKey | PQZYMGPNKZYTDB-ACCUITESSA-N |
| XLogP | 3.86 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|