C19H25NO4S — CID 6445098
(Z)-but-2-enedioic acid;1-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperidine (PubChem CID 6445098) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperidine.
| Compound Name | (Z)-but-2-enedioic acid;1-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperidine |
|---|---|
| PubChem CID | 6445098 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperidine |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc2c(c1)SCCCC2N1CCCCC1 |
| InChI | InChI=1S/C15H21NS.C4H4O4/c1-4-10-16(11-5-1)14-8-6-12-17-15-9-3-2-7-13(14)15;5-3(6)1-2-4(7)8/h2-3,7,9,14H,1,4-6,8,10-12H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | UXLJUQKZLCQCRS-BTJKTKAUSA-N |
| XLogP | 3.81 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|