C23H30N2O8S — CID 6445100
bis((Z)-but-2-enedioic acid);1-methyl-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperazine (PubChem CID 6445100) has the molecular formula C23H30N2O8S and a molecular weight of 494.57 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);1-methyl-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperazine.
| Compound Name | bis((Z)-but-2-enedioic acid);1-methyl-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperazine |
|---|---|
| PubChem CID | 6445100 |
| Molecular Formula | C23H30N2O8S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);1-methyl-4-(2,3,4,5-tetrahydro-1-benzothiepin-5-yl)piperazine |
| SMILES | CN1CCN(C2CCCSc3ccccc32)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H22N2S.2C4H4O4/c1-16-8-10-17(11-9-16)14-6-4-12-18-15-7-3-2-5-13(14)15;2*5-3(6)1-2-4(7)8/h2-3,5,7,14H,4,6,8-12H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | JRTPVROSRZRSSP-SPIKMXEPSA-N |
| XLogP | 2.28 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|