C23H26N2O6S — CID 6445149
(E)-but-2-enedioic acid;11-(4-methylpiperazin-1-yl)-6,11-dihydrobenzo[c][1]benzothiepine 5,5-dioxide (PubChem CID 6445149) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;11-(4-methylpiperazin-1-yl)-6,11-dihydrobenzo[c][1]benzothiepine 5,5-dioxide.
| Compound Name | (E)-but-2-enedioic acid;11-(4-methylpiperazin-1-yl)-6,11-dihydrobenzo[c][1]benzothiepine 5,5-dioxide |
|---|---|
| PubChem CID | 6445149 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (E)-but-2-enedioic acid;11-(4-methylpiperazin-1-yl)-6,11-dihydrobenzo[c][1]benzothiepine 5,5-dioxide |
| SMILES | CN1CCN(C2c3ccccc3CS(=O)(=O)c3ccccc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H22N2O2S.C4H4O4/c1-20-10-12-21(13-11-20)19-16-7-3-2-6-15(16)14-24(22,23)18-9-5-4-8-17(18)19;5-3(6)1-2-4(7)8/h2-9,19H,10-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QOJKVEVLASIERB-WLHGVMLRSA-N |
| XLogP | 2.02 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|