About (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine
(E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine (PubChem CID 6445199) has the molecular formula C23H26N2O4Se
and a molecular weight of 473.43 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine |
| PubChem CID | 6445199 |
| Molecular Formula | C23H26N2O4Se |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine |
| SMILES | CN1CCN(C2Cc3ccccc3[Se]c3ccccc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H22N2Se.C4H4O4/c1-20-10-12-21(13-11-20)17-14-15-6-2-4-8-18(15)22-19-9-5-3-7-16(17)19;5-3(6)1-2-4(7)8/h2-9,17H,10-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | BDFIJNCOFFEWEX-WLHGVMLRSA-N |
| XLogP | 0.90 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine?
The IUPAC name of (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine (CID 6445199) is (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine.
What is the SMILES notation for (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine?
The canonical SMILES for (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine is CN1CCN(C2Cc3ccccc3[Se]c3ccccc32)CC1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine?
The InChIKey is BDFIJNCOFFEWEX-WLHGVMLRSA-N. The full InChI is InChI=1S/C19H22N2Se.C4H4O4/c1-20-10-12-21(13-11-20)17-14-15-6-2-4-8-18(15)22-19-9-5-3-7-16(17)19;5-3(6)1-2-4(7)8/h2-9,17H,10-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine?
(E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine has a molecular weight of 473.43 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;1-(5,6-dihydrobenzo[b][1]benzoselenepin-5-yl)-4-methylpiperazine is sourced from PubChem (CID 6445199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).