C21H23ClN2O4S2 — CID 6445206
(E)-but-2-enedioic acid;1-(2-chloro-4,5-dihydrothieno[2,3-b][1]benzothiepin-4-yl)-4-methylpiperazine (PubChem CID 6445206) has the molecular formula C21H23ClN2O4S2 and a molecular weight of 467.01 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(2-chloro-4,5-dihydrothieno[2,3-b][1]benzothiepin-4-yl)-4-methylpiperazine.
| Compound Name | (E)-but-2-enedioic acid;1-(2-chloro-4,5-dihydrothieno[2,3-b][1]benzothiepin-4-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 6445206 |
| Molecular Formula | C21H23ClN2O4S2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(2-chloro-4,5-dihydrothieno[2,3-b][1]benzothiepin-4-yl)-4-methylpiperazine |
| SMILES | CN1CCN(C2Cc3ccccc3Sc3sc(Cl)cc32)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H19ClN2S2.C4H4O4/c1-19-6-8-20(9-7-19)14-10-12-4-2-3-5-15(12)21-17-13(14)11-16(18)22-17;5-3(6)1-2-4(7)8/h2-5,11,14H,6-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KOBLQASJCPSFGE-WLHGVMLRSA-N |
| XLogP | 4.11 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|