C24H25NO6 — CID 6445337
(E)-but-2-enedioic acid;2-(dimethylamino)ethyl tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carboxylate (PubChem CID 6445337) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(dimethylamino)ethyl tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carboxylate.
| Compound Name | (E)-but-2-enedioic acid;2-(dimethylamino)ethyl tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carboxylate |
|---|---|
| PubChem CID | 6445337 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(dimethylamino)ethyl tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carboxylate |
| SMILES | CN(C)CCOC(=O)C1=Cc2ccccc2Cc2ccccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H21NO2.C4H4O4/c1-21(2)11-12-23-20(22)19-14-16-8-4-3-7-15(16)13-17-9-5-6-10-18(17)19;5-3(6)1-2-4(7)8/h3-10,14H,11-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UNUKDQAZTDKTEN-WLHGVMLRSA-N |
| XLogP | 2.95 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|