C28H32N2O8 — CID 6445497
2-(16-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl)-N,N-dimethylethanamine;bis((E)-but-2-enedioic acid) (PubChem CID 6445497) has the molecular formula C28H32N2O8 and a molecular weight of 524.57 g/mol. Its IUPAC name is 2-(16-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl)-N,N-dimethylethanamine;bis((E)-but-2-enedioic acid).
| Compound Name | 2-(16-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl)-N,N-dimethylethanamine;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 6445497 |
| Molecular Formula | C28H32N2O8 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 2-(16-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl)-N,N-dimethylethanamine;bis((E)-but-2-enedioic acid) |
| SMILES | CN(C)CCC1NC2c3ccccc3CC1c1ccccc12.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H24N2.2C4H4O4/c1-22(2)12-11-19-18-13-14-7-3-4-8-15(14)20(21-19)17-10-6-5-9-16(17)18;2*5-3(6)1-2-4(7)8/h3-10,18-21H,11-13H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | KGNPKWNKJBCYRL-LVEZLNDCSA-N |
| XLogP | 2.76 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|