C25H27ClN2O4S — CID 6445584
(E)-but-2-enedioic acid;8-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-3-methyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 6445584) has the molecular formula C25H27ClN2O4S and a molecular weight of 487.02 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;8-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-3-methyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | (E)-but-2-enedioic acid;8-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-3-methyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 6445584 |
| Molecular Formula | C25H27ClN2O4S |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (E)-but-2-enedioic acid;8-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-3-methyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CN1CC2CCC(C1)N2C1Cc2ccccc2Sc2ccc(Cl)cc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H23ClN2S.C4H4O4/c1-23-12-16-7-8-17(13-23)24(16)19-10-14-4-2-3-5-20(14)25-21-9-6-15(22)11-18(19)21;5-3(6)1-2-4(7)8/h2-6,9,11,16-17,19H,7-8,10,12-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GGNGZIPZXPAATB-WLHGVMLRSA-N |
| XLogP | 4.58 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|