About (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate
(E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 6445592) has the molecular formula C25H30N2O6
and a molecular weight of 454.52 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate |
| PubChem CID | 6445592 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2ccccc2Cc2ccccc2)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H26N2O2.C4H4O4/c1-2-25-21(24)23-14-12-22(13-15-23)17-20-11-7-6-10-19(20)16-18-8-4-3-5-9-18;5-3(6)1-2-4(7)8/h3-11H,2,12-17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FWQQXNISHZKFIS-WLHGVMLRSA-N |
| XLogP | 3.26 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate?
The IUPAC name of (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate (CID 6445592) is (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate.
What is the SMILES notation for (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate?
The canonical SMILES for (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(Cc2ccccc2Cc2ccccc2)CC1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate?
The InChIKey is FWQQXNISHZKFIS-WLHGVMLRSA-N. The full InChI is InChI=1S/C21H26N2O2.C4H4O4/c1-2-25-21(24)23-14-12-22(13-15-23)17-20-11-7-6-10-19(20)16-18-8-4-3-5-9-18;5-3(6)1-2-4(7)8/h3-11H,2,12-17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate?
(E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate has a molecular weight of 454.52 g/mol, XLogP of 3.26, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;ethyl 4-[(2-benzylphenyl)methyl]piperazine-1-carboxylate is sourced from PubChem (CID 6445592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).